C14H23NO2 — CID 173005917
2-(nona-3,7-dienylamino)ethyl prop-2-enoate (PubChem CID 173005917) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is 2-(nona-3,7-dienylamino)ethyl prop-2-enoate.
| Compound Name | 2-(nona-3,7-dienylamino)ethyl prop-2-enoate |
|---|---|
| PubChem CID | 173005917 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | 2-(nona-3,7-dienylamino)ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCNCCC=CCCC=CC |
| InChI | InChI=1S/C14H23NO2/c1-3-5-6-7-8-9-10-11-15-12-13-17-14(16)4-2/h3-5,8-9,15H,2,6-7,10-13H2,1H3 |
| InChIKey | ITYBQMZJKXURGO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|