About (7-methyl-1,4-oxathiepan-3-yl) prop-2-enoate
(7-methyl-1,4-oxathiepan-3-yl) prop-2-enoate (PubChem CID 58183594) has the molecular formula C9H14O3S
and a molecular weight of 202.27 g/mol. Its IUPAC name is (7-methyl-1,4-oxathiepan-3-yl) prop-2-enoate.
Molecular Properties
| Compound Name | (7-methyl-1,4-oxathiepan-3-yl) prop-2-enoate |
| PubChem CID | 58183594 |
| Molecular Formula | C9H14O3S |
| Molecular Weight | 202.27 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | (7-methyl-1,4-oxathiepan-3-yl) prop-2-enoate |
| SMILES | C=CC(=O)OC1COC(C)CCS1 |
| InChI | InChI=1S/C9H14O3S/c1-3-8(10)12-9-6-11-7(2)4-5-13-9/h3,7,9H,1,4-6H2,2H3 |
| InChIKey | UIWRAVWHQZMTLP-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.27 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (7-methyl-1,4-oxathiepan-3-yl) prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-methyl-1,4-oxathiepan-3-yl) prop-2-enoate?
The IUPAC name of (7-methyl-1,4-oxathiepan-3-yl) prop-2-enoate (CID 58183594) is (7-methyl-1,4-oxathiepan-3-yl) prop-2-enoate.
What is the SMILES notation for (7-methyl-1,4-oxathiepan-3-yl) prop-2-enoate?
The canonical SMILES for (7-methyl-1,4-oxathiepan-3-yl) prop-2-enoate is C=CC(=O)OC1COC(C)CCS1.
What is the InChIKey of (7-methyl-1,4-oxathiepan-3-yl) prop-2-enoate?
The InChIKey is UIWRAVWHQZMTLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O3S/c1-3-8(10)12-9-6-11-7(2)4-5-13-9/h3,7,9H,1,4-6H2,2H3.
What are the key properties of (7-methyl-1,4-oxathiepan-3-yl) prop-2-enoate?
(7-methyl-1,4-oxathiepan-3-yl) prop-2-enoate has a molecular weight of 202.27 g/mol, XLogP of 1.58, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7-methyl-1,4-oxathiepan-3-yl) prop-2-enoate is sourced from PubChem (CID 58183594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).