C9H14O3S — CID 58183594
(7-methyl-1,4-oxathiepan-3-yl) prop-2-enoate (PubChem CID 58183594) has the molecular formula C9H14O3S and a molecular weight of 202.27 g/mol. Its IUPAC name is (7-methyl-1,4-oxathiepan-3-yl) prop-2-enoate.
| Compound Name | (7-methyl-1,4-oxathiepan-3-yl) prop-2-enoate |
|---|---|
| PubChem CID | 58183594 |
| Molecular Formula | C9H14O3S |
| Molecular Weight | 202.27 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | (7-methyl-1,4-oxathiepan-3-yl) prop-2-enoate |
| SMILES | C=CC(=O)OC1COC(C)CCS1 |
| InChI | InChI=1S/C9H14O3S/c1-3-8(10)12-9-6-11-7(2)4-5-13-9/h3,7,9H,1,4-6H2,2H3 |
| InChIKey | UIWRAVWHQZMTLP-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.27 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|