About (5,7-dimethyl-1,4-dithiepan-2-yl) prop-2-enoate
(5,7-dimethyl-1,4-dithiepan-2-yl) prop-2-enoate (PubChem CID 58105802) has the molecular formula C10H16O2S2
and a molecular weight of 232.37 g/mol. Its IUPAC name is (5,7-dimethyl-1,4-dithiepan-2-yl) prop-2-enoate.
Molecular Properties
| Compound Name | (5,7-dimethyl-1,4-dithiepan-2-yl) prop-2-enoate |
| PubChem CID | 58105802 |
| Molecular Formula | C10H16O2S2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | (5,7-dimethyl-1,4-dithiepan-2-yl) prop-2-enoate |
| SMILES | C=CC(=O)OC1CSC(C)CC(C)S1 |
| InChI | InChI=1S/C10H16O2S2/c1-4-9(11)12-10-6-13-7(2)5-8(3)14-10/h4,7-8,10H,1,5-6H2,2-3H3 |
| InChIKey | CDVQNDWSFGUCQD-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (5,7-dimethyl-1,4-dithiepan-2-yl) prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5,7-dimethyl-1,4-dithiepan-2-yl) prop-2-enoate?
The IUPAC name of (5,7-dimethyl-1,4-dithiepan-2-yl) prop-2-enoate (CID 58105802) is (5,7-dimethyl-1,4-dithiepan-2-yl) prop-2-enoate.
What is the SMILES notation for (5,7-dimethyl-1,4-dithiepan-2-yl) prop-2-enoate?
The canonical SMILES for (5,7-dimethyl-1,4-dithiepan-2-yl) prop-2-enoate is C=CC(=O)OC1CSC(C)CC(C)S1.
What is the InChIKey of (5,7-dimethyl-1,4-dithiepan-2-yl) prop-2-enoate?
The InChIKey is CDVQNDWSFGUCQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O2S2/c1-4-9(11)12-10-6-13-7(2)5-8(3)14-10/h4,7-8,10H,1,5-6H2,2-3H3.
What are the key properties of (5,7-dimethyl-1,4-dithiepan-2-yl) prop-2-enoate?
(5,7-dimethyl-1,4-dithiepan-2-yl) prop-2-enoate has a molecular weight of 232.37 g/mol, XLogP of 2.69, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5,7-dimethyl-1,4-dithiepan-2-yl) prop-2-enoate is sourced from PubChem (CID 58105802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).