About 1,4-oxathiocan-3-yl 2-bromoacetate
1,4-oxathiocan-3-yl 2-bromoacetate (PubChem CID 59637927) has the molecular formula C8H13BrO3S
and a molecular weight of 269.16 g/mol. Its IUPAC name is 1,4-oxathiocan-3-yl 2-bromoacetate.
Molecular Properties
| Compound Name | 1,4-oxathiocan-3-yl 2-bromoacetate |
| PubChem CID | 59637927 |
| Molecular Formula | C8H13BrO3S |
| Molecular Weight | 269.16 g/mol |
| Exact Mass | 267.98 |
| IUPAC Name | 1,4-oxathiocan-3-yl 2-bromoacetate |
| SMILES | O=C(CBr)OC1COCCCCS1 |
| InChI | InChI=1S/C8H13BrO3S/c9-5-7(10)12-8-6-11-3-1-2-4-13-8/h8H,1-6H2 |
| InChIKey | QSZUWSRDBSKVSU-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.16 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,4-oxathiocan-3-yl 2-bromoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-oxathiocan-3-yl 2-bromoacetate?
The IUPAC name of 1,4-oxathiocan-3-yl 2-bromoacetate (CID 59637927) is 1,4-oxathiocan-3-yl 2-bromoacetate.
What is the SMILES notation for 1,4-oxathiocan-3-yl 2-bromoacetate?
The canonical SMILES for 1,4-oxathiocan-3-yl 2-bromoacetate is O=C(CBr)OC1COCCCCS1.
What is the InChIKey of 1,4-oxathiocan-3-yl 2-bromoacetate?
The InChIKey is QSZUWSRDBSKVSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13BrO3S/c9-5-7(10)12-8-6-11-3-1-2-4-13-8/h8H,1-6H2.
What are the key properties of 1,4-oxathiocan-3-yl 2-bromoacetate?
1,4-oxathiocan-3-yl 2-bromoacetate has a molecular weight of 269.16 g/mol, XLogP of 1.79, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-oxathiocan-3-yl 2-bromoacetate is sourced from PubChem (CID 59637927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).