C12H11NO8S — CID 59623213
[2-[(2-isocyano-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl)oxy]-2-oxoethyl] prop-2-enoate (PubChem CID 59623213) has the molecular formula C12H11NO8S and a molecular weight of 329.29 g/mol. Its IUPAC name is [2-[(2-isocyano-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl)oxy]-2-oxoethyl] prop-2-enoate.
| Compound Name | [2-[(2-isocyano-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl)oxy]-2-oxoethyl] prop-2-enoate |
|---|---|
| PubChem CID | 59623213 |
| Molecular Formula | C12H11NO8S |
| Molecular Weight | 329.29 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | [2-[(2-isocyano-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl)oxy]-2-oxoethyl] prop-2-enoate |
| SMILES | [C-]#[N+]C1C2OC3C1OS(=O)(=O)C3C2OC(=O)COC(=O)C=C |
| InChI | InChI=1S/C12H11NO8S/c1-3-5(14)18-4-6(15)19-10-8-7(13-2)9-11(20-8)12(10)22(16,17)21-9/h3,7-12H,1,4H2 |
| InChIKey | XLKHTNIOBGNXAJ-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 109.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.29 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|