About 2-methyl-9-(trifluoromethyl)-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane 5,5-dioxide
2-methyl-9-(trifluoromethyl)-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane 5,5-dioxide (PubChem CID 59215489) has the molecular formula C9H11F3O3S
and a molecular weight of 256.25 g/mol. Its IUPAC name is 2-methyl-9-(trifluoromethyl)-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane 5,5-dioxide.
Molecular Properties
| Compound Name | 2-methyl-9-(trifluoromethyl)-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane 5,5-dioxide |
| PubChem CID | 59215489 |
| Molecular Formula | C9H11F3O3S |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 2-methyl-9-(trifluoromethyl)-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane 5,5-dioxide |
| SMILES | CC1C2CC3C1OS(=O)(=O)C3C2C(F)(F)F |
| InChI | InChI=1S/C9H11F3O3S/c1-3-4-2-5-7(3)15-16(13,14)8(5)6(4)9(10,11)12/h3-8H,2H2,1H3 |
| InChIKey | CMJSYDDTTWLUIP-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-9-(trifluoromethyl)-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane 5,5-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-9-(trifluoromethyl)-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane 5,5-dioxide?
The IUPAC name of 2-methyl-9-(trifluoromethyl)-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane 5,5-dioxide (CID 59215489) is 2-methyl-9-(trifluoromethyl)-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane 5,5-dioxide.
What is the SMILES notation for 2-methyl-9-(trifluoromethyl)-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane 5,5-dioxide?
The canonical SMILES for 2-methyl-9-(trifluoromethyl)-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane 5,5-dioxide is CC1C2CC3C1OS(=O)(=O)C3C2C(F)(F)F.
What is the InChIKey of 2-methyl-9-(trifluoromethyl)-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane 5,5-dioxide?
The InChIKey is CMJSYDDTTWLUIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F3O3S/c1-3-4-2-5-7(3)15-16(13,14)8(5)6(4)9(10,11)12/h3-8H,2H2,1H3.
What are the key properties of 2-methyl-9-(trifluoromethyl)-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane 5,5-dioxide?
2-methyl-9-(trifluoromethyl)-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane 5,5-dioxide has a molecular weight of 256.25 g/mol, XLogP of 1.55, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-9-(trifluoromethyl)-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane 5,5-dioxide is sourced from PubChem (CID 59215489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).