C9H12F2O6S2 — CID 118213392
2-[(5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-1,1-difluoroethanesulfinic acid (PubChem CID 118213392) has the molecular formula C9H12F2O6S2 and a molecular weight of 318.32 g/mol. Its IUPAC name is 2-[(5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-1,1-difluoroethanesulfinic acid.
| Compound Name | 2-[(5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-1,1-difluoroethanesulfinic acid |
|---|---|
| PubChem CID | 118213392 |
| Molecular Formula | C9H12F2O6S2 |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | 2-[(5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-1,1-difluoroethanesulfinic acid |
| SMILES | O=S(O)C(F)(F)COC1C2CC3C1OS(=O)(=O)C3C2 |
| InChI | InChI=1S/C9H12F2O6S2/c10-9(11,18(12)13)3-16-7-4-1-5-6(2-4)19(14,15)17-8(5)7/h4-8H,1-3H2,(H,12,13) |
| InChIKey | FUYVLVDYXQOTTJ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|