C19H22F2O9S2 — CID 118039474
4-[3-[(5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxycarbonyl]-2-bicyclo[2.2.1]hept-5-enyl]-1,1-difluoro-4-oxobutane-1-sulfonic acid (PubChem CID 118039474) has the molecular formula C19H22F2O9S2 and a molecular weight of 496.51 g/mol. Its IUPAC name is 4-[3-[(5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxycarbonyl]-2-bicyclo[2.2.1]hept-5-enyl]-1,1-difluoro-4-oxobutane-1-sulfonic acid.
| Compound Name | 4-[3-[(5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxycarbonyl]-2-bicyclo[2.2.1]hept-5-enyl]-1,1-difluoro-4-oxobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 118039474 |
| Molecular Formula | C19H22F2O9S2 |
| Molecular Weight | 496.51 g/mol |
| Exact Mass | 496.07 |
| IUPAC Name | 4-[3-[(5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxycarbonyl]-2-bicyclo[2.2.1]hept-5-enyl]-1,1-difluoro-4-oxobutane-1-sulfonic acid |
| SMILES | O=C(CCC(F)(F)S(=O)(=O)O)C1C2C=CC(C2)C1C(=O)OC1C2CC3C1OS(=O)(=O)C3C2 |
| InChI | InChI=1S/C19H22F2O9S2/c20-19(21,32(26,27)28)4-3-12(22)14-8-1-2-9(5-8)15(14)18(23)29-16-10-6-11-13(7-10)31(24,25)30-17(11)16/h1-2,8-11,13-17H,3-7H2,(H,26,27,28) |
| InChIKey | XAGDJGQKWAAHRU-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 141.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.51 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|