C15H25NO6S — CID 121380643
N-[2-[(5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxymethoxy]ethyl]-2,2-dimethylpropanamide (PubChem CID 121380643) has the molecular formula C15H25NO6S and a molecular weight of 347.43 g/mol. Its IUPAC name is N-[2-[(5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxymethoxy]ethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-[(5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxymethoxy]ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 121380643 |
| Molecular Formula | C15H25NO6S |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | N-[2-[(5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxymethoxy]ethyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NCCOCOC1C2CC3C1OS(=O)(=O)C3C2 |
| InChI | InChI=1S/C15H25NO6S/c1-15(2,3)14(17)16-4-5-20-8-21-12-9-6-10-11(7-9)23(18,19)22-13(10)12/h9-13H,4-8H2,1-3H3,(H,16,17) |
| InChIKey | WQAGMWNDPBCRPK-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|