C11H12F2O11S2 — CID 89000367
2-[2-(5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-2-carbonyl)oxyethoxy]-1,1-difluoro-2-oxoethanesulfonic acid (PubChem CID 89000367) has the molecular formula C11H12F2O11S2 and a molecular weight of 422.34 g/mol. Its IUPAC name is 2-[2-(5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-2-carbonyl)oxyethoxy]-1,1-difluoro-2-oxoethanesulfonic acid.
| Compound Name | 2-[2-(5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-2-carbonyl)oxyethoxy]-1,1-difluoro-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 89000367 |
| Molecular Formula | C11H12F2O11S2 |
| Molecular Weight | 422.34 g/mol |
| Exact Mass | 421.98 |
| IUPAC Name | 2-[2-(5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-2-carbonyl)oxyethoxy]-1,1-difluoro-2-oxoethanesulfonic acid |
| SMILES | O=C(OCCOC(=O)C(F)(F)S(=O)(=O)O)C1C2CC3C(O2)C1OS3(=O)=O |
| InChI | InChI=1S/C11H12F2O11S2/c12-11(13,26(18,19)20)10(15)22-2-1-21-9(14)6-4-3-5-7(23-4)8(6)24-25(5,16)17/h4-8H,1-3H2,(H,18,19,20) |
| InChIKey | BKCZBRKKCJSSCU-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 159.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.34 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|