C11H11F2O11S2- — CID 59623286
2-(2,2-difluoro-2-oxidoperoxysulfanylacetyl)oxyethyl 5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 59623286) has the molecular formula C11H11F2O11S2- and a molecular weight of 421.33 g/mol. Its IUPAC name is 2-(2,2-difluoro-2-oxidoperoxysulfanylacetyl)oxyethyl 5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-9-carboxylate.
| Compound Name | 2-(2,2-difluoro-2-oxidoperoxysulfanylacetyl)oxyethyl 5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-9-carboxylate |
|---|---|
| PubChem CID | 59623286 |
| Molecular Formula | C11H11F2O11S2- |
| Molecular Weight | 421.33 g/mol |
| Exact Mass | 420.97 |
| IUPAC Name | 2-(2,2-difluoro-2-oxidoperoxysulfanylacetyl)oxyethyl 5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | O=C(OCCOC(=O)C(F)(F)SOO[O-])C1C2CC3OS(=O)(=O)C1C3O2 |
| InChI | InChI=1S/C11H12F2O11S2/c12-11(13,25-24-23-16)10(15)20-2-1-19-9(14)6-4-3-5-7(21-4)8(6)26(17,18)22-5/h4-8,16H,1-3H2/p-1 |
| InChIKey | OGIUYYGGKGKONM-UHFFFAOYSA-M |
| XLogP | -1.58 |
| TPSA | 146.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.33 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|