C10H11F2O8S2- — CID 59623349
(1-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl) 2,2-difluoro-2-oxidoperoxysulfanylacetate (PubChem CID 59623349) has the molecular formula C10H11F2O8S2- and a molecular weight of 361.32 g/mol. Its IUPAC name is (1-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl) 2,2-difluoro-2-oxidoperoxysulfanylacetate.
| Compound Name | (1-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl) 2,2-difluoro-2-oxidoperoxysulfanylacetate |
|---|---|
| PubChem CID | 59623349 |
| Molecular Formula | C10H11F2O8S2- |
| Molecular Weight | 361.32 g/mol |
| Exact Mass | 360.99 |
| IUPAC Name | (1-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl) 2,2-difluoro-2-oxidoperoxysulfanylacetate |
| SMILES | CC12CC3C(OS(=O)(=O)C3C1)C2OC(=O)C(F)(F)SOO[O-] |
| InChI | InChI=1S/C10H12F2O8S2/c1-9-2-4-5(3-9)22(15,16)18-6(4)7(9)17-8(13)10(11,12)21-20-19-14/h4-7,14H,2-3H2,1H3/p-1 |
| InChIKey | NWIGXUNGCNTCNW-UHFFFAOYSA-M |
| XLogP | -0.11 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.32 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|