C13H18F2O8S2 — CID 59623187
(1,2,3,8-tetramethyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl) 2,2-difluoro-2-(trioxidanylsulfanyl)acetate (PubChem CID 59623187) has the molecular formula C13H18F2O8S2 and a molecular weight of 404.41 g/mol. Its IUPAC name is (1,2,3,8-tetramethyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl) 2,2-difluoro-2-(trioxidanylsulfanyl)acetate.
| Compound Name | (1,2,3,8-tetramethyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl) 2,2-difluoro-2-(trioxidanylsulfanyl)acetate |
|---|---|
| PubChem CID | 59623187 |
| Molecular Formula | C13H18F2O8S2 |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | (1,2,3,8-tetramethyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl) 2,2-difluoro-2-(trioxidanylsulfanyl)acetate |
| SMILES | CC1C2C3CC1(C)C(C)(OC(=O)C(F)(F)SOOO)C2(C)OS3(=O)=O |
| InChI | InChI=1S/C13H18F2O8S2/c1-6-8-7-5-10(6,2)12(4,11(8,3)21-25(7,18)19)20-9(16)13(14,15)24-23-22-17/h6-8,17H,5H2,1-4H3 |
| InChIKey | WGFRQWOSMGTVLI-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|