C16H22O6S2 — CID 88591482
(1,2,3,8-tetramethyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl) 2-prop-2-enoylsulfanylacetate (PubChem CID 88591482) has the molecular formula C16H22O6S2 and a molecular weight of 374.48 g/mol. Its IUPAC name is (1,2,3,8-tetramethyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl) 2-prop-2-enoylsulfanylacetate.
| Compound Name | (1,2,3,8-tetramethyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl) 2-prop-2-enoylsulfanylacetate |
|---|---|
| PubChem CID | 88591482 |
| Molecular Formula | C16H22O6S2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | (1,2,3,8-tetramethyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl) 2-prop-2-enoylsulfanylacetate |
| SMILES | C=CC(=O)SCC(=O)OC1(C)C2(C)CC3C(C2C)C1(C)OS3(=O)=O |
| InChI | InChI=1S/C16H22O6S2/c1-6-12(18)23-8-11(17)21-16(5)14(3)7-10-13(9(14)2)15(16,4)22-24(10,19)20/h6,9-10,13H,1,7-8H2,2-5H3 |
| InChIKey | UVOSGYYAWFKFAV-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|