C12H18O2S3 — CID 54127542
S-[[5-(prop-2-enoylsulfanylmethyl)thiolan-2-yl]methyl] propanethioate (PubChem CID 54127542) has the molecular formula C12H18O2S3 and a molecular weight of 290.47 g/mol. Its IUPAC name is S-[[5-(prop-2-enoylsulfanylmethyl)thiolan-2-yl]methyl] propanethioate.
| Compound Name | S-[[5-(prop-2-enoylsulfanylmethyl)thiolan-2-yl]methyl] propanethioate |
|---|---|
| PubChem CID | 54127542 |
| Molecular Formula | C12H18O2S3 |
| Molecular Weight | 290.47 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | S-[[5-(prop-2-enoylsulfanylmethyl)thiolan-2-yl]methyl] propanethioate |
| SMILES | C=CC(=O)SCC1CCC(CSC(=O)CC)S1 |
| InChI | InChI=1S/C12H18O2S3/c1-3-11(13)15-7-9-5-6-10(17-9)8-16-12(14)4-2/h3,9-10H,1,4-8H2,2H3 |
| InChIKey | NSAUHCLAJWBCJM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|