C13H20O2S4 — CID 163685934
S-[[5-(propanoylsulfanylmethyl)-1,4-dithian-2-yl]methyl] 2-methylprop-2-enethioate (PubChem CID 163685934) has the molecular formula C13H20O2S4 and a molecular weight of 336.57 g/mol. Its IUPAC name is S-[[5-(propanoylsulfanylmethyl)-1,4-dithian-2-yl]methyl] 2-methylprop-2-enethioate.
| Compound Name | S-[[5-(propanoylsulfanylmethyl)-1,4-dithian-2-yl]methyl] 2-methylprop-2-enethioate |
|---|---|
| PubChem CID | 163685934 |
| Molecular Formula | C13H20O2S4 |
| Molecular Weight | 336.57 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | S-[[5-(propanoylsulfanylmethyl)-1,4-dithian-2-yl]methyl] 2-methylprop-2-enethioate |
| SMILES | C=C(C)C(=O)SCC1CSC(CSC(=O)CC)CS1 |
| InChI | InChI=1S/C13H20O2S4/c1-4-12(14)18-7-10-5-17-11(6-16-10)8-19-13(15)9(2)3/h10-11H,2,4-8H2,1,3H3 |
| InChIKey | JOWOMJGQIGGHSJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.57 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|