C13H22OS4 — CID 22670092
S-[3-[1-(1,3-dithiolan-4-yl)propan-2-ylsulfanyl]propyl] 2-methylprop-2-enethioate (PubChem CID 22670092) has the molecular formula C13H22OS4 and a molecular weight of 322.59 g/mol. Its IUPAC name is S-[3-[1-(1,3-dithiolan-4-yl)propan-2-ylsulfanyl]propyl] 2-methylprop-2-enethioate.
| Compound Name | S-[3-[1-(1,3-dithiolan-4-yl)propan-2-ylsulfanyl]propyl] 2-methylprop-2-enethioate |
|---|---|
| PubChem CID | 22670092 |
| Molecular Formula | C13H22OS4 |
| Molecular Weight | 322.59 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | S-[3-[1-(1,3-dithiolan-4-yl)propan-2-ylsulfanyl]propyl] 2-methylprop-2-enethioate |
| SMILES | C=C(C)C(=O)SCCCSC(C)CC1CSCS1 |
| InChI | InChI=1S/C13H22OS4/c1-10(2)13(14)17-6-4-5-16-11(3)7-12-8-15-9-18-12/h11-12H,1,4-9H2,2-3H3 |
| InChIKey | QKRDCGOUMFZCTQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.59 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|