C13H20O2S3 — CID 18991460
S-[3-[2-(2-methylprop-2-enoylsulfanyl)ethylsulfanyl]propyl] 2-methylprop-2-enethioate (PubChem CID 18991460) has the molecular formula C13H20O2S3 and a molecular weight of 304.50 g/mol. Its IUPAC name is S-[3-[2-(2-methylprop-2-enoylsulfanyl)ethylsulfanyl]propyl] 2-methylprop-2-enethioate.
| Compound Name | S-[3-[2-(2-methylprop-2-enoylsulfanyl)ethylsulfanyl]propyl] 2-methylprop-2-enethioate |
|---|---|
| PubChem CID | 18991460 |
| Molecular Formula | C13H20O2S3 |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | S-[3-[2-(2-methylprop-2-enoylsulfanyl)ethylsulfanyl]propyl] 2-methylprop-2-enethioate |
| SMILES | C=C(C)C(=O)SCCCSCCSC(=O)C(=C)C |
| InChI | InChI=1S/C13H20O2S3/c1-10(2)12(14)17-7-5-6-16-8-9-18-13(15)11(3)4/h1,3,5-9H2,2,4H3 |
| InChIKey | NJSUNVVBJOCUNQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|