C12H20O4S2 — CID 87484627
ethane-1,2-diol;S-[2-(2-methylprop-2-enoylsulfanyl)ethyl] 2-methylprop-2-enethioate (PubChem CID 87484627) has the molecular formula C12H20O4S2 and a molecular weight of 292.42 g/mol. Its IUPAC name is ethane-1,2-diol;S-[2-(2-methylprop-2-enoylsulfanyl)ethyl] 2-methylprop-2-enethioate.
| Compound Name | ethane-1,2-diol;S-[2-(2-methylprop-2-enoylsulfanyl)ethyl] 2-methylprop-2-enethioate |
|---|---|
| PubChem CID | 87484627 |
| Molecular Formula | C12H20O4S2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | ethane-1,2-diol;S-[2-(2-methylprop-2-enoylsulfanyl)ethyl] 2-methylprop-2-enethioate |
| SMILES | C=C(C)C(=O)SCCSC(=O)C(=C)C.OCCO |
| InChI | InChI=1S/C10H14O2S2.C2H6O2/c1-7(2)9(11)13-5-6-14-10(12)8(3)4;3-1-2-4/h1,3,5-6H2,2,4H3;3-4H,1-2H2 |
| InChIKey | IZLVGVISDFDEIJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|