C6H9NaO4S2 — CID 118002499
sodium 2-(2-methylprop-2-enoylsulfanyl)ethanesulfonate (PubChem CID 118002499) has the molecular formula C6H9NaO4S2 and a molecular weight of 232.26 g/mol. Its IUPAC name is sodium 2-(2-methylprop-2-enoylsulfanyl)ethanesulfonate.
| Compound Name | sodium 2-(2-methylprop-2-enoylsulfanyl)ethanesulfonate |
|---|---|
| PubChem CID | 118002499 |
| Molecular Formula | C6H9NaO4S2 |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 231.98 |
| IUPAC Name | sodium 2-(2-methylprop-2-enoylsulfanyl)ethanesulfonate |
| SMILES | C=C(C)C(=O)SCCS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C6H10O4S2.Na/c1-5(2)6(7)11-3-4-12(8,9)10;/h1,3-4H2,2H3,(H,8,9,10);/q;+1/p-1 |
| InChIKey | LFGBEQMGGCCPSP-UHFFFAOYSA-M |
| XLogP | -2.63 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | -2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|