C4H7NaO3S — CID 23663624
sodium 2-methylprop-2-ene-1-sulfonate (PubChem CID 23663624) has the molecular formula C4H7NaO3S and a molecular weight of 158.15 g/mol. Its IUPAC name is sodium 2-methylprop-2-ene-1-sulfonate.
| Compound Name | sodium 2-methylprop-2-ene-1-sulfonate |
|---|---|
| PubChem CID | 23663624 |
| Molecular Formula | C4H7NaO3S |
| Molecular Weight | 158.15 g/mol |
| Exact Mass | 158.00 |
| IUPAC Name | sodium 2-methylprop-2-ene-1-sulfonate |
| SMILES | C=C(C)CS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C4H8O3S.Na/c1-4(2)3-8(5,6)7;/h1,3H2,2H3,(H,5,6,7);/q;+1/p-1 |
| InChIKey | SZHIIIPPJJXYRY-UHFFFAOYSA-M |
| XLogP | -2.89 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.15 |
| LogP ≤ 5 | -2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|