C10H23NO3S — CID 174514420
N,N-diethylethanamine;2-methylprop-2-ene-1-sulfonic acid (PubChem CID 174514420) has the molecular formula C10H23NO3S and a molecular weight of 237.36 g/mol. Its IUPAC name is N,N-diethylethanamine;2-methylprop-2-ene-1-sulfonic acid.
| Compound Name | N,N-diethylethanamine;2-methylprop-2-ene-1-sulfonic acid |
|---|---|
| PubChem CID | 174514420 |
| Molecular Formula | C10H23NO3S |
| Molecular Weight | 237.36 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | N,N-diethylethanamine;2-methylprop-2-ene-1-sulfonic acid |
| SMILES | C=C(C)CS(=O)(=O)O.CCN(CC)CC |
| InChI | InChI=1S/C6H15N.C4H8O3S/c1-4-7(5-2)6-3;1-4(2)3-8(5,6)7/h4-6H2,1-3H3;1,3H2,2H3,(H,5,6,7) |
| InChIKey | OMSYTPZQELKDCB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.36 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|