C8H14N2O3S — CID 173379549
1-methylimidazole;2-methylprop-2-ene-1-sulfonic acid (PubChem CID 173379549) has the molecular formula C8H14N2O3S and a molecular weight of 218.28 g/mol. Its IUPAC name is 1-methylimidazole;2-methylprop-2-ene-1-sulfonic acid.
| Compound Name | 1-methylimidazole;2-methylprop-2-ene-1-sulfonic acid |
|---|---|
| PubChem CID | 173379549 |
| Molecular Formula | C8H14N2O3S |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 1-methylimidazole;2-methylprop-2-ene-1-sulfonic acid |
| SMILES | C=C(C)CS(=O)(=O)O.Cn1ccnc1 |
| InChI | InChI=1S/C4H6N2.C4H8O3S/c1-6-3-2-5-4-6;1-4(2)3-8(5,6)7/h2-4H,1H3;1,3H2,2H3,(H,5,6,7) |
| InChIKey | KGDACLKUXRFGRH-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|