C8H17F3N2O3S2 — CID 174974522
1-methylimidazole;propane-1-sulfonic acid;trifluoro(methyl)-λ4-sulfane (PubChem CID 174974522) has the molecular formula C8H17F3N2O3S2 and a molecular weight of 310.36 g/mol. Its IUPAC name is 1-methylimidazole;propane-1-sulfonic acid;trifluoro(methyl)-λ4-sulfane.
| Compound Name | 1-methylimidazole;propane-1-sulfonic acid;trifluoro(methyl)-λ4-sulfane |
|---|---|
| PubChem CID | 174974522 |
| Molecular Formula | C8H17F3N2O3S2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 1-methylimidazole;propane-1-sulfonic acid;trifluoro(methyl)-λ4-sulfane |
| SMILES | CCCS(=O)(=O)O.CS(F)(F)F.Cn1ccnc1 |
| InChI | InChI=1S/C4H6N2.C3H8O3S.CH3F3S/c1-6-3-2-5-4-6;1-2-3-7(4,5)6;1-5(2,3)4/h2-4H,1H3;2-3H2,1H3,(H,4,5,6);1H3 |
| InChIKey | ZCXGPDRIYUUCNE-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|