About sodium 1-hydroxyethenesulfonate
sodium 1-hydroxyethenesulfonate (PubChem CID 23720822) has the molecular formula C2H3NaO4S
and a molecular weight of 146.10 g/mol. Its IUPAC name is sodium 1-hydroxyethenesulfonate.
Molecular Properties
| Compound Name | sodium 1-hydroxyethenesulfonate |
| PubChem CID | 23720822 |
| Molecular Formula | C2H3NaO4S |
| Molecular Weight | 146.10 g/mol |
| Exact Mass | 145.96 |
| IUPAC Name | sodium 1-hydroxyethenesulfonate |
| SMILES | C=C(O)S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C2H4O4S.Na/c1-2(3)7(4,5)6;/h3H,1H2,(H,4,5,6);/q;+1/p-1 |
| InChIKey | LXVNWFUJICFZHS-UHFFFAOYSA-M |
| XLogP | -3.44 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.10 |
| LogP ≤ 5 | -3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium 1-hydroxyethenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 1-hydroxyethenesulfonate?
The IUPAC name of sodium 1-hydroxyethenesulfonate (CID 23720822) is sodium 1-hydroxyethenesulfonate.
What is the SMILES notation for sodium 1-hydroxyethenesulfonate?
The canonical SMILES for sodium 1-hydroxyethenesulfonate is C=C(O)S(=O)(=O)[O-].[Na+].
What is the InChIKey of sodium 1-hydroxyethenesulfonate?
The InChIKey is LXVNWFUJICFZHS-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H4O4S.Na/c1-2(3)7(4,5)6;/h3H,1H2,(H,4,5,6);/q;+1/p-1.
What are the key properties of sodium 1-hydroxyethenesulfonate?
sodium 1-hydroxyethenesulfonate has a molecular weight of 146.10 g/mol, XLogP of -3.44, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 1-hydroxyethenesulfonate is sourced from PubChem (CID 23720822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).