CH2Na2O6S2 — CID 18517882
disodium;carbonic acid;dioxido-oxo-sulfanylidene-λ6-sulfane (PubChem CID 18517882) has the molecular formula CH2Na2O6S2 and a molecular weight of 220.13 g/mol. Its IUPAC name is disodium;carbonic acid;dioxido-oxo-sulfanylidene-λ6-sulfane.
| Compound Name | disodium;carbonic acid;dioxido-oxo-sulfanylidene-λ6-sulfane |
|---|---|
| PubChem CID | 18517882 |
| Molecular Formula | CH2Na2O6S2 |
| Molecular Weight | 220.13 g/mol |
| Exact Mass | 219.91 |
| IUPAC Name | disodium;carbonic acid;dioxido-oxo-sulfanylidene-λ6-sulfane |
| SMILES | O=C(O)O.O=S([O-])([O-])=S.[Na+].[Na+] |
| InChI | InChI=1S/CH2O3.2Na.H2O3S2/c2-1(3)4;;;1-5(2,3)4/h(H2,2,3,4);;;(H2,1,2,3,4)/q;2*+1;/p-2 |
| InChIKey | VBONSGYHXIPMDN-UHFFFAOYSA-L |
| XLogP | -6.78 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.13 |
| LogP ≤ 5 | -6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |