C3H6Na2O6S2 — CID 162247764
disodium;dioxido-oxo-sulfanylidene-λ6-sulfane;2-hydroxypropanoic acid (PubChem CID 162247764) has the molecular formula C3H6Na2O6S2 and a molecular weight of 248.19 g/mol. Its IUPAC name is disodium;dioxido-oxo-sulfanylidene-λ6-sulfane;2-hydroxypropanoic acid.
| Compound Name | disodium;dioxido-oxo-sulfanylidene-λ6-sulfane;2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 162247764 |
| Molecular Formula | C3H6Na2O6S2 |
| Molecular Weight | 248.19 g/mol |
| Exact Mass | 247.94 |
| IUPAC Name | disodium;dioxido-oxo-sulfanylidene-λ6-sulfane;2-hydroxypropanoic acid |
| SMILES | CC(O)C(=O)O.O=S([O-])([O-])=S.[Na+].[Na+] |
| InChI | InChI=1S/C3H6O3.2Na.H2O3S2/c1-2(4)3(5)6;;;1-5(2,3)4/h2,4H,1H3,(H,5,6);;;(H2,1,2,3,4)/q;2*+1;/p-2 |
| InChIKey | ZXOLJSYOLACENK-UHFFFAOYSA-L |
| XLogP | -7.55 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.19 |
| LogP ≤ 5 | -7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |