C17H29NO3S — CID 19803329
benzyl(triethyl)azanium;2-methylprop-2-ene-1-sulfonate (PubChem CID 19803329) has the molecular formula C17H29NO3S and a molecular weight of 327.49 g/mol. Its IUPAC name is benzyl(triethyl)azanium;2-methylprop-2-ene-1-sulfonate.
| Compound Name | benzyl(triethyl)azanium;2-methylprop-2-ene-1-sulfonate |
|---|---|
| PubChem CID | 19803329 |
| Molecular Formula | C17H29NO3S |
| Molecular Weight | 327.49 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | benzyl(triethyl)azanium;2-methylprop-2-ene-1-sulfonate |
| SMILES | C=C(C)CS(=O)(=O)[O-].CC[N+](CC)(CC)Cc1ccccc1 |
| InChI | InChI=1S/C13H22N.C4H8O3S/c1-4-14(5-2,6-3)12-13-10-8-7-9-11-13;1-4(2)3-8(5,6)7/h7-11H,4-6,12H2,1-3H3;1,3H2,2H3,(H,5,6,7)/q+1;/p-1 |
| InChIKey | LARGTHREAYSKLG-UHFFFAOYSA-M |
| XLogP | 3.17 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.49 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|