C10H18O5S3 — CID 172748162
3-[2-methylprop-2-enoyloxy(2-methylsulfanylethyl)sulfonio]propane-1-sulfonate (PubChem CID 172748162) has the molecular formula C10H18O5S3 and a molecular weight of 314.45 g/mol. Its IUPAC name is 3-[2-methylprop-2-enoyloxy(2-methylsulfanylethyl)sulfonio]propane-1-sulfonate.
| Compound Name | 3-[2-methylprop-2-enoyloxy(2-methylsulfanylethyl)sulfonio]propane-1-sulfonate |
|---|---|
| PubChem CID | 172748162 |
| Molecular Formula | C10H18O5S3 |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 3-[2-methylprop-2-enoyloxy(2-methylsulfanylethyl)sulfonio]propane-1-sulfonate |
| SMILES | C=C(C)C(=O)O[S+](CCCS(=O)(=O)[O-])CCSC |
| InChI | InChI=1S/C10H18O5S3/c1-9(2)10(11)15-17(7-5-16-3)6-4-8-18(12,13)14/h1,4-8H2,2-3H3 |
| InChIKey | JZUAQMSUWZRAKR-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|