C25H51O5PS — CID 161217318
3-(2-methylprop-2-enoyloxy)propane-1-sulfonate;tributyl(hexyl)phosphanium (PubChem CID 161217318) has the molecular formula C25H51O5PS and a molecular weight of 494.72 g/mol. Its IUPAC name is 3-(2-methylprop-2-enoyloxy)propane-1-sulfonate;tributyl(hexyl)phosphanium.
| Compound Name | 3-(2-methylprop-2-enoyloxy)propane-1-sulfonate;tributyl(hexyl)phosphanium |
|---|---|
| PubChem CID | 161217318 |
| Molecular Formula | C25H51O5PS |
| Molecular Weight | 494.72 g/mol |
| Exact Mass | 494.32 |
| IUPAC Name | 3-(2-methylprop-2-enoyloxy)propane-1-sulfonate;tributyl(hexyl)phosphanium |
| SMILES | C=C(C)C(=O)OCCCS(=O)(=O)[O-].CCCCCC[P+](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C18H40P.C7H12O5S/c1-5-9-13-14-18-19(15-10-6-2,16-11-7-3)17-12-8-4;1-6(2)7(8)12-4-3-5-13(9,10)11/h5-18H2,1-4H3;1,3-5H2,2H3,(H,9,10,11)/q+1;/p-1 |
| InChIKey | UXAQHTQVBPTITJ-UHFFFAOYSA-M |
| XLogP | 7.03 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.72 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|