C18H36IO2P — CID 22119382
tributyl-[2-(2-methylprop-2-enoyloxy)ethyl]phosphanium iodide (PubChem CID 22119382) has the molecular formula C18H36IO2P and a molecular weight of 442.36 g/mol. Its IUPAC name is tributyl-[2-(2-methylprop-2-enoyloxy)ethyl]phosphanium iodide.
| Compound Name | tributyl-[2-(2-methylprop-2-enoyloxy)ethyl]phosphanium iodide |
|---|---|
| PubChem CID | 22119382 |
| Molecular Formula | C18H36IO2P |
| Molecular Weight | 442.36 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | tributyl-[2-(2-methylprop-2-enoyloxy)ethyl]phosphanium iodide |
| SMILES | C=C(C)C(=O)OCC[P+](CCCC)(CCCC)CCCC.[I-] |
| InChI | InChI=1S/C18H36O2P.HI/c1-6-9-13-21(14-10-7-2,15-11-8-3)16-12-20-18(19)17(4)5;/h4,6-16H2,1-3,5H3;1H/q+1;/p-1 |
| InChIKey | TVKQGYCNSRBDRH-UHFFFAOYSA-M |
| XLogP | 2.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|