C18H36O2P+ — CID 20776618
tributyl-[2-(2-methylprop-2-enoyloxy)ethyl]phosphanium (PubChem CID 20776618) has the molecular formula C18H36O2P+ and a molecular weight of 315.46 g/mol. Its IUPAC name is tributyl-[2-(2-methylprop-2-enoyloxy)ethyl]phosphanium.
| Compound Name | tributyl-[2-(2-methylprop-2-enoyloxy)ethyl]phosphanium |
|---|---|
| PubChem CID | 20776618 |
| Molecular Formula | C18H36O2P+ |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.24 |
| IUPAC Name | tributyl-[2-(2-methylprop-2-enoyloxy)ethyl]phosphanium |
| SMILES | C=C(C)C(=O)OCC[P+](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C18H36O2P/c1-6-9-13-21(14-10-7-2,15-11-8-3)16-12-20-18(19)17(4)5/h4,6-16H2,1-3,5H3/q+1 |
| InChIKey | XNYZAMMWQBKWBP-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|