C16H31NO5S — CID 140867409
3-[butyl-[3-methyl-4-(2-methylprop-2-enoyloxy)butyl]azaniumyl]propane-1-sulfonate (PubChem CID 140867409) has the molecular formula C16H31NO5S and a molecular weight of 349.49 g/mol. Its IUPAC name is 3-[butyl-[3-methyl-4-(2-methylprop-2-enoyloxy)butyl]azaniumyl]propane-1-sulfonate.
| Compound Name | 3-[butyl-[3-methyl-4-(2-methylprop-2-enoyloxy)butyl]azaniumyl]propane-1-sulfonate |
|---|---|
| PubChem CID | 140867409 |
| Molecular Formula | C16H31NO5S |
| Molecular Weight | 349.49 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 3-[butyl-[3-methyl-4-(2-methylprop-2-enoyloxy)butyl]azaniumyl]propane-1-sulfonate |
| SMILES | C=C(C)C(=O)OCC(C)CC[NH+](CCCC)CCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C16H31NO5S/c1-5-6-9-17(10-7-12-23(19,20)21)11-8-15(4)13-22-16(18)14(2)3/h15H,2,5-13H2,1,3-4H3,(H,19,20,21) |
| InChIKey | YJZFOGMDVLBFSS-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 87.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.49 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|