C11H15NO5S — CID 87218095
2-(2-methylprop-2-enoyloxy)ethanesulfonate;pyridin-1-ium (PubChem CID 87218095) has the molecular formula C11H15NO5S and a molecular weight of 273.31 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoyloxy)ethanesulfonate;pyridin-1-ium.
| Compound Name | 2-(2-methylprop-2-enoyloxy)ethanesulfonate;pyridin-1-ium |
|---|---|
| PubChem CID | 87218095 |
| Molecular Formula | C11H15NO5S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 2-(2-methylprop-2-enoyloxy)ethanesulfonate;pyridin-1-ium |
| SMILES | C=C(C)C(=O)OCCS(=O)(=O)[O-].c1cc[nH+]cc1 |
| InChI | InChI=1S/C6H10O5S.C5H5N/c1-5(2)6(7)11-3-4-12(8,9)10;1-2-4-6-5-3-1/h1,3-4H2,2H3,(H,8,9,10);1-5H |
| InChIKey | LEFQWWHHBAVPHE-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 97.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|