C16H32N2O8S — CID 156858936
bis(ethyl-dimethyl-(2-methylprop-2-enoyloxy)azanium);sulfate (PubChem CID 156858936) has the molecular formula C16H32N2O8S and a molecular weight of 412.51 g/mol. Its IUPAC name is bis(ethyl-dimethyl-(2-methylprop-2-enoyloxy)azanium);sulfate.
| Compound Name | bis(ethyl-dimethyl-(2-methylprop-2-enoyloxy)azanium);sulfate |
|---|---|
| PubChem CID | 156858936 |
| Molecular Formula | C16H32N2O8S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | bis(ethyl-dimethyl-(2-methylprop-2-enoyloxy)azanium);sulfate |
| SMILES | C=C(C)C(=O)O[N+](C)(C)CC.C=C(C)C(=O)O[N+](C)(C)CC.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/2C8H16NO2.H2O4S/c2*1-6-9(4,5)11-8(10)7(2)3;1-5(2,3)4/h2*2,6H2,1,3-5H3;(H2,1,2,3,4)/q2*+1;/p-2 |
| InChIKey | RZRSTCIEVZIFKA-UHFFFAOYSA-L |
| XLogP | 0.90 |
| TPSA | 132.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|