C24H48N2O8S — CID 174448437
bis(diethyl-methyl-[1-(2-methylprop-2-enoyloxy)propyl]azanium);sulfate (PubChem CID 174448437) has the molecular formula C24H48N2O8S and a molecular weight of 524.72 g/mol. Its IUPAC name is bis(diethyl-methyl-[1-(2-methylprop-2-enoyloxy)propyl]azanium);sulfate.
| Compound Name | bis(diethyl-methyl-[1-(2-methylprop-2-enoyloxy)propyl]azanium);sulfate |
|---|---|
| PubChem CID | 174448437 |
| Molecular Formula | C24H48N2O8S |
| Molecular Weight | 524.72 g/mol |
| Exact Mass | 524.31 |
| IUPAC Name | bis(diethyl-methyl-[1-(2-methylprop-2-enoyloxy)propyl]azanium);sulfate |
| SMILES | C=C(C)C(=O)OC(CC)[N+](C)(CC)CC.C=C(C)C(=O)OC(CC)[N+](C)(CC)CC.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/2C12H24NO2.H2O4S/c2*1-7-11(13(6,8-2)9-3)15-12(14)10(4)5;1-5(2,3)4/h2*11H,4,7-9H2,1-3,5-6H3;(H2,1,2,3,4)/q2*+1;/p-2 |
| InChIKey | CSKZKQAGEKCIAK-UHFFFAOYSA-L |
| XLogP | 3.32 |
| TPSA | 132.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.72 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|