C13H26NO5S+ — CID 101198873
3-[diethyl-[2-(2-methyl-1-oxoniumylideneprop-2-enoxy)ethyl]azaniumyl]propane-1-sulfonate (PubChem CID 101198873) has the molecular formula C13H26NO5S+ and a molecular weight of 308.42 g/mol. Its IUPAC name is 3-[diethyl-[2-(2-methyl-1-oxoniumylideneprop-2-enoxy)ethyl]azaniumyl]propane-1-sulfonate.
| Compound Name | 3-[diethyl-[2-(2-methyl-1-oxoniumylideneprop-2-enoxy)ethyl]azaniumyl]propane-1-sulfonate |
|---|---|
| PubChem CID | 101198873 |
| Molecular Formula | C13H26NO5S+ |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 3-[diethyl-[2-(2-methyl-1-oxoniumylideneprop-2-enoxy)ethyl]azaniumyl]propane-1-sulfonate |
| SMILES | [H]/[O+]=C(/OCC[N+](CC)(CC)CCCS(=O)(=O)[O-])C(=C)C |
| InChI | InChI=1S/C13H25NO5S/c1-5-14(6-2,8-7-11-20(16,17)18)9-10-19-13(15)12(3)4/h3,5-11H2,1-2,4H3/p+1 |
| InChIKey | OPSSRPUCUJITAA-UHFFFAOYSA-O |
| XLogP | 0.87 |
| TPSA | 87.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|