About sulfuric acid;4-(triethylazaniumyl)butane-1-sulfonate
sulfuric acid;4-(triethylazaniumyl)butane-1-sulfonate (PubChem CID 171376195) has the molecular formula C10H25NO7S2
and a molecular weight of 335.44 g/mol. Its IUPAC name is sulfuric acid;4-(triethylazaniumyl)butane-1-sulfonate.
Molecular Properties
| Compound Name | sulfuric acid;4-(triethylazaniumyl)butane-1-sulfonate |
| PubChem CID | 171376195 |
| Molecular Formula | C10H25NO7S2 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | sulfuric acid;4-(triethylazaniumyl)butane-1-sulfonate |
| SMILES | CC[N+](CC)(CC)CCCCS(=O)(=O)[O-].O=S(=O)(O)O |
| InChI | InChI=1S/C10H23NO3S.H2O4S/c1-4-11(5-2,6-3)9-7-8-10-15(12,13)14;1-5(2,3)4/h4-10H2,1-3H3;(H2,1,2,3,4) |
| InChIKey | HRPHYHKXMQISJC-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 131.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sulfuric acid;4-(triethylazaniumyl)butane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfuric acid;4-(triethylazaniumyl)butane-1-sulfonate?
The IUPAC name of sulfuric acid;4-(triethylazaniumyl)butane-1-sulfonate (CID 171376195) is sulfuric acid;4-(triethylazaniumyl)butane-1-sulfonate.
What is the SMILES notation for sulfuric acid;4-(triethylazaniumyl)butane-1-sulfonate?
The canonical SMILES for sulfuric acid;4-(triethylazaniumyl)butane-1-sulfonate is CC[N+](CC)(CC)CCCCS(=O)(=O)[O-].O=S(=O)(O)O.
What is the InChIKey of sulfuric acid;4-(triethylazaniumyl)butane-1-sulfonate?
The InChIKey is HRPHYHKXMQISJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23NO3S.H2O4S/c1-4-11(5-2,6-3)9-7-8-10-15(12,13)14;1-5(2,3)4/h4-10H2,1-3H3;(H2,1,2,3,4).
What are the key properties of sulfuric acid;4-(triethylazaniumyl)butane-1-sulfonate?
sulfuric acid;4-(triethylazaniumyl)butane-1-sulfonate has a molecular weight of 335.44 g/mol, XLogP of 0.54, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sulfuric acid;4-(triethylazaniumyl)butane-1-sulfonate is sourced from PubChem (CID 171376195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).