About 4-chlorobutane-1-sulfonate;tetrabutylazanium
4-chlorobutane-1-sulfonate;tetrabutylazanium (PubChem CID 86654806) has the molecular formula C20H44ClNO3S
and a molecular weight of 414.10 g/mol. Its IUPAC name is 4-chlorobutane-1-sulfonate;tetrabutylazanium.
Molecular Properties
| Compound Name | 4-chlorobutane-1-sulfonate;tetrabutylazanium |
| PubChem CID | 86654806 |
| Molecular Formula | C20H44ClNO3S |
| Molecular Weight | 414.10 g/mol |
| Exact Mass | 413.27 |
| IUPAC Name | 4-chlorobutane-1-sulfonate;tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.O=S(=O)([O-])CCCCCl |
| InChI | InChI=1S/C16H36N.C4H9ClO3S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;5-3-1-2-4-9(6,7)8/h5-16H2,1-4H3;1-4H2,(H,6,7,8)/q+1;/p-1 |
| InChIKey | LAULXFCSGSZAAF-UHFFFAOYSA-M |
| XLogP | 5.55 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.10 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-chlorobutane-1-sulfonate;tetrabutylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chlorobutane-1-sulfonate;tetrabutylazanium?
The IUPAC name of 4-chlorobutane-1-sulfonate;tetrabutylazanium (CID 86654806) is 4-chlorobutane-1-sulfonate;tetrabutylazanium.
What is the SMILES notation for 4-chlorobutane-1-sulfonate;tetrabutylazanium?
The canonical SMILES for 4-chlorobutane-1-sulfonate;tetrabutylazanium is CCCC[N+](CCCC)(CCCC)CCCC.O=S(=O)([O-])CCCCCl.
What is the InChIKey of 4-chlorobutane-1-sulfonate;tetrabutylazanium?
The InChIKey is LAULXFCSGSZAAF-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H36N.C4H9ClO3S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;5-3-1-2-4-9(6,7)8/h5-16H2,1-4H3;1-4H2,(H,6,7,8)/q+1;/p-1.
What are the key properties of 4-chlorobutane-1-sulfonate;tetrabutylazanium?
4-chlorobutane-1-sulfonate;tetrabutylazanium has a molecular weight of 414.10 g/mol, XLogP of 5.55, 16 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chlorobutane-1-sulfonate;tetrabutylazanium is sourced from PubChem (CID 86654806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).