potassium 4-chlorobutane-1-sulfonate

C4H8ClKO3S — CID 88775129

IUPACpotassium 4-chlorobutane-1-sulfonate
SMILESO=S(=O)([O-])CCCCCl.[K+]
InChIInChI=1S/C4H9ClO3S.K/c5-3-1-2-4-9(6,7)8;/h1-4H2,(H,6,7,8);/q;+1/p-1
InChIKeyZEPGTXRHRZNJLR-UHFFFAOYSA-M
MW210.72 g/mol
LogP-2.45
Rot. Bonds4

About potassium 4-chlorobutane-1-sulfonate

potassium 4-chlorobutane-1-sulfonate (PubChem CID 88775129) has the molecular formula C4H8ClKO3S and a molecular weight of 210.72 g/mol. Its IUPAC name is potassium 4-chlorobutane-1-sulfonate.

Molecular Properties

Compound Namepotassium 4-chlorobutane-1-sulfonate
PubChem CID88775129
Molecular FormulaC4H8ClKO3S
Molecular Weight210.72 g/mol
Exact Mass209.95
IUPAC Namepotassium 4-chlorobutane-1-sulfonate
SMILESO=S(=O)([O-])CCCCCl.[K+]
InChIInChI=1S/C4H9ClO3S.K/c5-3-1-2-4-9(6,7)8;/h1-4H2,(H,6,7,8);/q;+1/p-1
InChIKeyZEPGTXRHRZNJLR-UHFFFAOYSA-M
XLogP-2.45
TPSA57.20 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.72
LogP ≤ 5-2.45
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze potassium 4-chlorobutane-1-sulfonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium 4-chlorobutane-1-sulfonate?
The IUPAC name of potassium 4-chlorobutane-1-sulfonate (CID 88775129) is potassium 4-chlorobutane-1-sulfonate.
What is the SMILES notation for potassium 4-chlorobutane-1-sulfonate?
The canonical SMILES for potassium 4-chlorobutane-1-sulfonate is O=S(=O)([O-])CCCCCl.[K+].
What is the InChIKey of potassium 4-chlorobutane-1-sulfonate?
The InChIKey is ZEPGTXRHRZNJLR-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H9ClO3S.K/c5-3-1-2-4-9(6,7)8;/h1-4H2,(H,6,7,8);/q;+1/p-1.
What are the key properties of potassium 4-chlorobutane-1-sulfonate?
potassium 4-chlorobutane-1-sulfonate has a molecular weight of 210.72 g/mol, XLogP of -2.45, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 4-chlorobutane-1-sulfonate is sourced from PubChem (CID 88775129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).