About dihydrogen phosphate;triethyl(3-sulfopropyl)azanium
dihydrogen phosphate;triethyl(3-sulfopropyl)azanium (PubChem CID 167413337) has the molecular formula C9H24NO7PS
and a molecular weight of 321.33 g/mol. Its IUPAC name is dihydrogen phosphate;triethyl(3-sulfopropyl)azanium.
Molecular Properties
| Compound Name | dihydrogen phosphate;triethyl(3-sulfopropyl)azanium |
| PubChem CID | 167413337 |
| Molecular Formula | C9H24NO7PS |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | dihydrogen phosphate;triethyl(3-sulfopropyl)azanium |
| SMILES | CC[N+](CC)(CC)CCCS(=O)(=O)O.O=P([O-])(O)O |
| InChI | InChI=1S/C9H21NO3S.H3O4P/c1-4-10(5-2,6-3)8-7-9-14(11,12)13;1-5(2,3)4/h4-9H2,1-3H3;(H3,1,2,3,4) |
| InChIKey | MNYHPMRCNZVGHV-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 134.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze dihydrogen phosphate;triethyl(3-sulfopropyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydrogen phosphate;triethyl(3-sulfopropyl)azanium?
The IUPAC name of dihydrogen phosphate;triethyl(3-sulfopropyl)azanium (CID 167413337) is dihydrogen phosphate;triethyl(3-sulfopropyl)azanium.
What is the SMILES notation for dihydrogen phosphate;triethyl(3-sulfopropyl)azanium?
The canonical SMILES for dihydrogen phosphate;triethyl(3-sulfopropyl)azanium is CC[N+](CC)(CC)CCCS(=O)(=O)O.O=P([O-])(O)O.
What is the InChIKey of dihydrogen phosphate;triethyl(3-sulfopropyl)azanium?
The InChIKey is MNYHPMRCNZVGHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21NO3S.H3O4P/c1-4-10(5-2,6-3)8-7-9-14(11,12)13;1-5(2,3)4/h4-9H2,1-3H3;(H3,1,2,3,4).
What are the key properties of dihydrogen phosphate;triethyl(3-sulfopropyl)azanium?
dihydrogen phosphate;triethyl(3-sulfopropyl)azanium has a molecular weight of 321.33 g/mol, XLogP of -0.42, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dihydrogen phosphate;triethyl(3-sulfopropyl)azanium is sourced from PubChem (CID 167413337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).