C13H28N2O4S — CID 171465518
3-[diethyl-[2-(2-methylpropanoylamino)ethyl]azaniumyl]propane-1-sulfonate (PubChem CID 171465518) has the molecular formula C13H28N2O4S and a molecular weight of 308.44 g/mol. Its IUPAC name is 3-[diethyl-[2-(2-methylpropanoylamino)ethyl]azaniumyl]propane-1-sulfonate.
| Compound Name | 3-[diethyl-[2-(2-methylpropanoylamino)ethyl]azaniumyl]propane-1-sulfonate |
|---|---|
| PubChem CID | 171465518 |
| Molecular Formula | C13H28N2O4S |
| Molecular Weight | 308.44 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 3-[diethyl-[2-(2-methylpropanoylamino)ethyl]azaniumyl]propane-1-sulfonate |
| SMILES | CC[N+](CC)(CCCS(=O)(=O)[O-])CCNC(=O)C(C)C |
| InChI | InChI=1S/C13H28N2O4S/c1-5-15(6-2,9-7-11-20(17,18)19)10-8-14-13(16)12(3)4/h12H,5-11H2,1-4H3,(H-,14,16,17,18,19) |
| InChIKey | LYVZVLKWCZREME-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.44 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|