C10H23N2O5S+ — CID 171465522
dimethyl-[2-(2-methylpropanoylamino)ethyl]-(2-sulfooxyethyl)azanium (PubChem CID 171465522) has the molecular formula C10H23N2O5S+ and a molecular weight of 283.37 g/mol. Its IUPAC name is dimethyl-[2-(2-methylpropanoylamino)ethyl]-(2-sulfooxyethyl)azanium.
| Compound Name | dimethyl-[2-(2-methylpropanoylamino)ethyl]-(2-sulfooxyethyl)azanium |
|---|---|
| PubChem CID | 171465522 |
| Molecular Formula | C10H23N2O5S+ |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | dimethyl-[2-(2-methylpropanoylamino)ethyl]-(2-sulfooxyethyl)azanium |
| SMILES | CC(C)C(=O)NCC[N+](C)(C)CCOS(=O)(=O)O |
| InChI | InChI=1S/C10H22N2O5S/c1-9(2)10(13)11-5-6-12(3,4)7-8-17-18(14,15)16/h9H,5-8H2,1-4H3,(H-,11,13,14,15,16)/p+1 |
| InChIKey | MAYQXZXHTCJBBB-UHFFFAOYSA-O |
| XLogP | -0.35 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|