C13H29N2O3+ — CID 89398810
4-hydroperoxybutyl-dimethyl-[2-(2-methylbutanoylamino)ethyl]azanium (PubChem CID 89398810) has the molecular formula C13H29N2O3+ and a molecular weight of 261.39 g/mol. Its IUPAC name is 4-hydroperoxybutyl-dimethyl-[2-(2-methylbutanoylamino)ethyl]azanium.
| Compound Name | 4-hydroperoxybutyl-dimethyl-[2-(2-methylbutanoylamino)ethyl]azanium |
|---|---|
| PubChem CID | 89398810 |
| Molecular Formula | C13H29N2O3+ |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | 4-hydroperoxybutyl-dimethyl-[2-(2-methylbutanoylamino)ethyl]azanium |
| SMILES | CCC(C)C(=O)NCC[N+](C)(C)CCCCOO |
| InChI | InChI=1S/C13H28N2O3/c1-5-12(2)13(16)14-8-10-15(3,4)9-6-7-11-18-17/h12H,5-11H2,1-4H3,(H-,14,16,17)/p+1 |
| InChIKey | NLGUOTNUQCMXOJ-UHFFFAOYSA-O |
| XLogP | 1.49 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|