C16H36N2O10S2+2 — CID 171465484
dimethyl-[2-[methyl-[2-(2-methylpropanoyloxy)ethyl]-(3-sulfooxypropyl)azaniumyl]ethyl]-(2-sulfooxyethyl)azanium (PubChem CID 171465484) has the molecular formula C16H36N2O10S2+2 and a molecular weight of 480.60 g/mol. Its IUPAC name is dimethyl-[2-[methyl-[2-(2-methylpropanoyloxy)ethyl]-(3-sulfooxypropyl)azaniumyl]ethyl]-(2-sulfooxyethyl)azanium.
| Compound Name | dimethyl-[2-[methyl-[2-(2-methylpropanoyloxy)ethyl]-(3-sulfooxypropyl)azaniumyl]ethyl]-(2-sulfooxyethyl)azanium |
|---|---|
| PubChem CID | 171465484 |
| Molecular Formula | C16H36N2O10S2+2 |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | dimethyl-[2-[methyl-[2-(2-methylpropanoyloxy)ethyl]-(3-sulfooxypropyl)azaniumyl]ethyl]-(2-sulfooxyethyl)azanium |
| SMILES | CC(C)C(=O)OCC[N+](C)(CCCOS(=O)(=O)O)CC[N+](C)(C)CCOS(=O)(=O)O |
| InChI | InChI=1S/C16H34N2O10S2/c1-15(2)16(19)26-13-11-18(5,7-6-12-27-29(20,21)22)9-8-17(3,4)10-14-28-30(23,24)25/h15H,6-14H2,1-5H3/p+2 |
| InChIKey | YSDMTCKBLSDKHF-UHFFFAOYSA-P |
| XLogP | -0.26 |
| TPSA | 153.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|