C15H24O2S4 — CID 15218572
S-[2-[3-[2-(2-methylprop-2-enoylsulfanyl)ethylsulfanyl]propylsulfanyl]ethyl] 2-methylprop-2-enethioate (PubChem CID 15218572) has the molecular formula C15H24O2S4 and a molecular weight of 364.62 g/mol. Its IUPAC name is S-[2-[3-[2-(2-methylprop-2-enoylsulfanyl)ethylsulfanyl]propylsulfanyl]ethyl] 2-methylprop-2-enethioate.
| Compound Name | S-[2-[3-[2-(2-methylprop-2-enoylsulfanyl)ethylsulfanyl]propylsulfanyl]ethyl] 2-methylprop-2-enethioate |
|---|---|
| PubChem CID | 15218572 |
| Molecular Formula | C15H24O2S4 |
| Molecular Weight | 364.62 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | S-[2-[3-[2-(2-methylprop-2-enoylsulfanyl)ethylsulfanyl]propylsulfanyl]ethyl] 2-methylprop-2-enethioate |
| SMILES | C=C(C)C(=O)SCCSCCCSCCSC(=O)C(=C)C |
| InChI | InChI=1S/C15H24O2S4/c1-12(2)14(16)20-10-8-18-6-5-7-19-9-11-21-15(17)13(3)4/h1,3,5-11H2,2,4H3 |
| InChIKey | AGGHKNDQWUYBAS-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.62 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|