C10H14O5S — CID 175327355
2-[2-(2-methylprop-2-enoylsulfanyl)ethyl]butanedioic acid (PubChem CID 175327355) has the molecular formula C10H14O5S and a molecular weight of 246.28 g/mol. Its IUPAC name is 2-[2-(2-methylprop-2-enoylsulfanyl)ethyl]butanedioic acid.
| Compound Name | 2-[2-(2-methylprop-2-enoylsulfanyl)ethyl]butanedioic acid |
|---|---|
| PubChem CID | 175327355 |
| Molecular Formula | C10H14O5S |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 2-[2-(2-methylprop-2-enoylsulfanyl)ethyl]butanedioic acid |
| SMILES | C=C(C)C(=O)SCCC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H14O5S/c1-6(2)10(15)16-4-3-7(9(13)14)5-8(11)12/h7H,1,3-5H2,2H3,(H,11,12)(H,13,14) |
| InChIKey | YZGLPBKMGQAPBI-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|