C14H24O4S2 — CID 122646510
S-[2-[2-[2-(2-methylprop-2-enoylsulfanyl)ethoxy]ethoxy]ethyl] 2-methylpropanethioate (PubChem CID 122646510) has the molecular formula C14H24O4S2 and a molecular weight of 320.48 g/mol. Its IUPAC name is S-[2-[2-[2-(2-methylprop-2-enoylsulfanyl)ethoxy]ethoxy]ethyl] 2-methylpropanethioate.
| Compound Name | S-[2-[2-[2-(2-methylprop-2-enoylsulfanyl)ethoxy]ethoxy]ethyl] 2-methylpropanethioate |
|---|---|
| PubChem CID | 122646510 |
| Molecular Formula | C14H24O4S2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | S-[2-[2-[2-(2-methylprop-2-enoylsulfanyl)ethoxy]ethoxy]ethyl] 2-methylpropanethioate |
| SMILES | C=C(C)C(=O)SCCOCCOCCSC(=O)C(C)C |
| InChI | InChI=1S/C14H24O4S2/c1-11(2)13(15)19-9-7-17-5-6-18-8-10-20-14(16)12(3)4/h12H,1,5-10H2,2-4H3 |
| InChIKey | WJZVYJYUYXHUQD-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|