C28H34O4S5 — CID 139719439
S-[2-[1-[4-[4-[1-[2-(2-methylprop-2-enoylsulfanyl)ethoxy]ethylsulfanyl]phenyl]sulfanylphenyl]sulfanylethoxy]ethyl] 2-methylprop-2-enethioate (PubChem CID 139719439) has the molecular formula C28H34O4S5 and a molecular weight of 594.91 g/mol. Its IUPAC name is S-[2-[1-[4-[4-[1-[2-(2-methylprop-2-enoylsulfanyl)ethoxy]ethylsulfanyl]phenyl]sulfanylphenyl]sulfanylethoxy]ethyl] 2-methylprop-2-enethioate.
| Compound Name | S-[2-[1-[4-[4-[1-[2-(2-methylprop-2-enoylsulfanyl)ethoxy]ethylsulfanyl]phenyl]sulfanylphenyl]sulfanylethoxy]ethyl] 2-methylprop-2-enethioate |
|---|---|
| PubChem CID | 139719439 |
| Molecular Formula | C28H34O4S5 |
| Molecular Weight | 594.91 g/mol |
| Exact Mass | 594.11 |
| IUPAC Name | S-[2-[1-[4-[4-[1-[2-(2-methylprop-2-enoylsulfanyl)ethoxy]ethylsulfanyl]phenyl]sulfanylphenyl]sulfanylethoxy]ethyl] 2-methylprop-2-enethioate |
| SMILES | C=C(C)C(=O)SCCOC(C)Sc1ccc(Sc2ccc(SC(C)OCCSC(=O)C(=C)C)cc2)cc1 |
| InChI | InChI=1S/C28H34O4S5/c1-19(2)27(29)33-17-15-31-21(5)35-23-7-11-25(12-8-23)37-26-13-9-24(10-14-26)36-22(6)32-16-18-34-28(30)20(3)4/h7-14,21-22H,1,3,15-18H2,2,4-6H3 |
| InChIKey | AVQWMAYSKJRKQR-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.91 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|