C33H28O2S6 — CID 170192084
S-[2-[4-[[4-[2-(2-methylprop-2-enoylsulfanyl)phenyl]sulfanylphenyl]sulfanylmethylsulfanyl]phenyl]sulfanylphenyl] 2-methylprop-2-enethioate (PubChem CID 170192084) has the molecular formula C33H28O2S6 and a molecular weight of 648.99 g/mol. Its IUPAC name is S-[2-[4-[[4-[2-(2-methylprop-2-enoylsulfanyl)phenyl]sulfanylphenyl]sulfanylmethylsulfanyl]phenyl]sulfanylphenyl] 2-methylprop-2-enethioate.
| Compound Name | S-[2-[4-[[4-[2-(2-methylprop-2-enoylsulfanyl)phenyl]sulfanylphenyl]sulfanylmethylsulfanyl]phenyl]sulfanylphenyl] 2-methylprop-2-enethioate |
|---|---|
| PubChem CID | 170192084 |
| Molecular Formula | C33H28O2S6 |
| Molecular Weight | 648.99 g/mol |
| Exact Mass | 648.04 |
| IUPAC Name | S-[2-[4-[[4-[2-(2-methylprop-2-enoylsulfanyl)phenyl]sulfanylphenyl]sulfanylmethylsulfanyl]phenyl]sulfanylphenyl] 2-methylprop-2-enethioate |
| SMILES | C=C(C)C(=O)Sc1ccccc1Sc1ccc(SCSc2ccc(Sc3ccccc3SC(=O)C(=C)C)cc2)cc1 |
| InChI | InChI=1S/C33H28O2S6/c1-22(2)32(34)40-30-11-7-5-9-28(30)38-26-17-13-24(14-18-26)36-21-37-25-15-19-27(20-16-25)39-29-10-6-8-12-31(29)41-33(35)23(3)4/h5-20H,1,3,21H2,2,4H3 |
| InChIKey | JNLMHKOIICECPQ-UHFFFAOYSA-N |
| XLogP | 11.22 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.99 |
| LogP ≤ 5 | 11.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|